C29H33NO4 — CID 67846629
1-[4-[2-(1,3-benzodioxol-5-yl)-1-phenylbut-1-enyl]phenoxy]-3-[ethyl(methyl)amino]propan-2-ol (PubChem CID 67846629) has the molecular formula C29H33NO4 and a molecular weight of 459.59 g/mol. Its IUPAC name is 1-[4-[2-(1,3-benzodioxol-5-yl)-1-phenylbut-1-enyl]phenoxy]-3-[ethyl(methyl)amino]propan-2-ol.
| Compound Name | 1-[4-[2-(1,3-benzodioxol-5-yl)-1-phenylbut-1-enyl]phenoxy]-3-[ethyl(methyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 67846629 |
| Molecular Formula | C29H33NO4 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 1-[4-[2-(1,3-benzodioxol-5-yl)-1-phenylbut-1-enyl]phenoxy]-3-[ethyl(methyl)amino]propan-2-ol |
| SMILES | CCC(=C(c1ccccc1)c1ccc(OCC(O)CN(C)CC)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C29H33NO4/c1-4-26(23-13-16-27-28(17-23)34-20-33-27)29(21-9-7-6-8-10-21)22-11-14-25(15-12-22)32-19-24(31)18-30(3)5-2/h6-17,24,31H,4-5,18-20H2,1-3H3 |
| InChIKey | XTPFPDUPFFVHFQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|