C32H40N2O5 — CID 67847172
2-[4-[2-(1,3-benzodioxol-5-yl)-1-[4-(methoxymethoxy)phenyl]but-1-enyl]phenoxy]-N,N,N',N'-tetramethylpropane-1,3-diamine (PubChem CID 67847172) has the molecular formula C32H40N2O5 and a molecular weight of 532.68 g/mol. Its IUPAC name is 2-[4-[2-(1,3-benzodioxol-5-yl)-1-[4-(methoxymethoxy)phenyl]but-1-enyl]phenoxy]-N,N,N',N'-tetramethylpropane-1,3-diamine.
| Compound Name | 2-[4-[2-(1,3-benzodioxol-5-yl)-1-[4-(methoxymethoxy)phenyl]but-1-enyl]phenoxy]-N,N,N',N'-tetramethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 67847172 |
| Molecular Formula | C32H40N2O5 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | 2-[4-[2-(1,3-benzodioxol-5-yl)-1-[4-(methoxymethoxy)phenyl]but-1-enyl]phenoxy]-N,N,N',N'-tetramethylpropane-1,3-diamine |
| SMILES | CCC(=C(c1ccc(OCOC)cc1)c1ccc(OC(CN(C)C)CN(C)C)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C32H40N2O5/c1-7-29(25-12-17-30-31(18-25)38-22-37-30)32(23-8-13-26(14-9-23)36-21-35-6)24-10-15-27(16-11-24)39-28(19-33(2)3)20-34(4)5/h8-18,28H,7,19-22H2,1-6H3 |
| InChIKey | KHVZRXRJTNPAPD-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 52.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|