C32H35NO7 — CID 67846802
[4-[1-[4-[2-acetyloxy-3-(dimethylamino)propoxy]phenyl]-2-(1,3-benzodioxol-5-yl)but-1-enyl]phenyl] acetate (PubChem CID 67846802) has the molecular formula C32H35NO7 and a molecular weight of 545.63 g/mol. Its IUPAC name is [4-[1-[4-[2-acetyloxy-3-(dimethylamino)propoxy]phenyl]-2-(1,3-benzodioxol-5-yl)but-1-enyl]phenyl] acetate.
| Compound Name | [4-[1-[4-[2-acetyloxy-3-(dimethylamino)propoxy]phenyl]-2-(1,3-benzodioxol-5-yl)but-1-enyl]phenyl] acetate |
|---|---|
| PubChem CID | 67846802 |
| Molecular Formula | C32H35NO7 |
| Molecular Weight | 545.63 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | [4-[1-[4-[2-acetyloxy-3-(dimethylamino)propoxy]phenyl]-2-(1,3-benzodioxol-5-yl)but-1-enyl]phenyl] acetate |
| SMILES | CCC(=C(c1ccc(OCC(CN(C)C)OC(C)=O)cc1)c1ccc(OC(C)=O)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C32H35NO7/c1-6-29(25-11-16-30-31(17-25)38-20-37-30)32(24-9-14-27(15-10-24)39-21(2)34)23-7-12-26(13-8-23)36-19-28(18-33(4)5)40-22(3)35/h7-17,28H,6,18-20H2,1-5H3 |
| InChIKey | DOVWFDIGFGOTRU-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.63 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|