C29H31NO6 — CID 67847072
[4-[2-(1,3-benzodioxol-5-yl)-1-[4-[2-hydroxy-3-(methylamino)propoxy]phenyl]but-1-enyl]phenyl] acetate (PubChem CID 67847072) has the molecular formula C29H31NO6 and a molecular weight of 489.57 g/mol. Its IUPAC name is [4-[2-(1,3-benzodioxol-5-yl)-1-[4-[2-hydroxy-3-(methylamino)propoxy]phenyl]but-1-enyl]phenyl] acetate.
| Compound Name | [4-[2-(1,3-benzodioxol-5-yl)-1-[4-[2-hydroxy-3-(methylamino)propoxy]phenyl]but-1-enyl]phenyl] acetate |
|---|---|
| PubChem CID | 67847072 |
| Molecular Formula | C29H31NO6 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | [4-[2-(1,3-benzodioxol-5-yl)-1-[4-[2-hydroxy-3-(methylamino)propoxy]phenyl]but-1-enyl]phenyl] acetate |
| SMILES | CCC(=C(c1ccc(OCC(O)CNC)cc1)c1ccc(OC(C)=O)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C29H31NO6/c1-4-26(22-9-14-27-28(15-22)35-18-34-27)29(21-7-12-25(13-8-21)36-19(2)31)20-5-10-24(11-6-20)33-17-23(32)16-30-3/h5-15,23,30,32H,4,16-18H2,1-3H3 |
| InChIKey | WPPFCFIVHQMUCF-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|