C32H35NO6 — CID 67846647
[4-[2-(1,3-benzodioxol-5-yl)-1-[4-[3-(ethylamino)-2-hydroxypropoxy]phenyl]but-1-enyl]phenyl] cyclopropanecarboxylate (PubChem CID 67846647) has the molecular formula C32H35NO6 and a molecular weight of 529.63 g/mol. Its IUPAC name is [4-[2-(1,3-benzodioxol-5-yl)-1-[4-[3-(ethylamino)-2-hydroxypropoxy]phenyl]but-1-enyl]phenyl] cyclopropanecarboxylate.
| Compound Name | [4-[2-(1,3-benzodioxol-5-yl)-1-[4-[3-(ethylamino)-2-hydroxypropoxy]phenyl]but-1-enyl]phenyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 67846647 |
| Molecular Formula | C32H35NO6 |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | [4-[2-(1,3-benzodioxol-5-yl)-1-[4-[3-(ethylamino)-2-hydroxypropoxy]phenyl]but-1-enyl]phenyl] cyclopropanecarboxylate |
| SMILES | CCNCC(O)COc1ccc(C(=C(CC)c2ccc3c(c2)OCO3)c2ccc(OC(=O)C3CC3)cc2)cc1 |
| InChI | InChI=1S/C32H35NO6/c1-3-28(24-11-16-29-30(17-24)38-20-37-29)31(22-9-14-27(15-10-22)39-32(35)23-5-6-23)21-7-12-26(13-8-21)36-19-25(34)18-33-4-2/h7-17,23,25,33-34H,3-6,18-20H2,1-2H3 |
| InChIKey | BVQKMGIYGTXUOZ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|