C31H35NO5 — CID 67847030
4-[2-(1,3-benzodioxol-5-yl)-1-[4-[3-(cyclopentylamino)-2-hydroxypropoxy]phenyl]but-1-enyl]phenol (PubChem CID 67847030) has the molecular formula C31H35NO5 and a molecular weight of 501.62 g/mol. Its IUPAC name is 4-[2-(1,3-benzodioxol-5-yl)-1-[4-[3-(cyclopentylamino)-2-hydroxypropoxy]phenyl]but-1-enyl]phenol.
| Compound Name | 4-[2-(1,3-benzodioxol-5-yl)-1-[4-[3-(cyclopentylamino)-2-hydroxypropoxy]phenyl]but-1-enyl]phenol |
|---|---|
| PubChem CID | 67847030 |
| Molecular Formula | C31H35NO5 |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | 4-[2-(1,3-benzodioxol-5-yl)-1-[4-[3-(cyclopentylamino)-2-hydroxypropoxy]phenyl]but-1-enyl]phenol |
| SMILES | CCC(=C(c1ccc(O)cc1)c1ccc(OCC(O)CNC2CCCC2)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C31H35NO5/c1-2-28(23-11-16-29-30(17-23)37-20-36-29)31(21-7-12-25(33)13-8-21)22-9-14-27(15-10-22)35-19-26(34)18-32-24-5-3-4-6-24/h7-17,24,26,32-34H,2-6,18-20H2,1H3 |
| InChIKey | BDZYLWJMKPNNJM-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 80.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|