C30H35NO3 — CID 67847089
4-[1-[4-[3-(cyclopentylamino)-2-hydroxypropoxy]phenyl]-2-phenylbut-1-enyl]phenol (PubChem CID 67847089) has the molecular formula C30H35NO3 and a molecular weight of 457.61 g/mol. Its IUPAC name is 4-[1-[4-[3-(cyclopentylamino)-2-hydroxypropoxy]phenyl]-2-phenylbut-1-enyl]phenol.
| Compound Name | 4-[1-[4-[3-(cyclopentylamino)-2-hydroxypropoxy]phenyl]-2-phenylbut-1-enyl]phenol |
|---|---|
| PubChem CID | 67847089 |
| Molecular Formula | C30H35NO3 |
| Molecular Weight | 457.61 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | 4-[1-[4-[3-(cyclopentylamino)-2-hydroxypropoxy]phenyl]-2-phenylbut-1-enyl]phenol |
| SMILES | CCC(=C(c1ccc(O)cc1)c1ccc(OCC(O)CNC2CCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H35NO3/c1-2-29(22-8-4-3-5-9-22)30(23-12-16-26(32)17-13-23)24-14-18-28(19-15-24)34-21-27(33)20-31-25-10-6-7-11-25/h3-5,8-9,12-19,25,27,31-33H,2,6-7,10-11,20-21H2,1H3 |
| InChIKey | IVQJFOKZMFEWJB-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.61 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|