C29H33NO3 — CID 67847087
4-[2-cyclopropyl-1-[4-[2-hydroxy-3-(propylamino)propoxy]phenyl]-2-phenylethenyl]phenol (PubChem CID 67847087) has the molecular formula C29H33NO3 and a molecular weight of 443.59 g/mol. Its IUPAC name is 4-[2-cyclopropyl-1-[4-[2-hydroxy-3-(propylamino)propoxy]phenyl]-2-phenylethenyl]phenol.
| Compound Name | 4-[2-cyclopropyl-1-[4-[2-hydroxy-3-(propylamino)propoxy]phenyl]-2-phenylethenyl]phenol |
|---|---|
| PubChem CID | 67847087 |
| Molecular Formula | C29H33NO3 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | 4-[2-cyclopropyl-1-[4-[2-hydroxy-3-(propylamino)propoxy]phenyl]-2-phenylethenyl]phenol |
| SMILES | CCCNCC(O)COc1ccc(C(=C(c2ccccc2)C2CC2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C29H33NO3/c1-2-18-30-19-26(32)20-33-27-16-12-24(13-17-27)29(23-10-14-25(31)15-11-23)28(22-8-9-22)21-6-4-3-5-7-21/h3-7,10-17,22,26,30-32H,2,8-9,18-20H2,1H3 |
| InChIKey | SBGPFKVZBYJNDX-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|