C30H35NO4 — CID 67846828
[4-[(E)-1-[4-[2-hydroxy-3-(propylamino)propoxy]phenyl]-2-phenylbut-1-enyl]phenyl] acetate (PubChem CID 67846828) has the molecular formula C30H35NO4 and a molecular weight of 473.61 g/mol. Its IUPAC name is [4-[(E)-1-[4-[2-hydroxy-3-(propylamino)propoxy]phenyl]-2-phenylbut-1-enyl]phenyl] acetate.
| Compound Name | [4-[(E)-1-[4-[2-hydroxy-3-(propylamino)propoxy]phenyl]-2-phenylbut-1-enyl]phenyl] acetate |
|---|---|
| PubChem CID | 67846828 |
| Molecular Formula | C30H35NO4 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | [4-[(E)-1-[4-[2-hydroxy-3-(propylamino)propoxy]phenyl]-2-phenylbut-1-enyl]phenyl] acetate |
| SMILES | CCCNCC(O)COc1ccc(/C(=C(/CC)c2ccccc2)c2ccc(OC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C30H35NO4/c1-4-19-31-20-26(33)21-34-27-15-11-24(12-16-27)30(29(5-2)23-9-7-6-8-10-23)25-13-17-28(18-14-25)35-22(3)32/h6-18,26,31,33H,4-5,19-21H2,1-3H3/b30-29+ |
| InChIKey | FREVMIBASAKBNE-QVIHXGFCSA-N |
| XLogP | 5.72 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|