C31H35NO4 — CID 67846798
[4-[1-[4-[3-(dimethylamino)-2-hydroxypropoxy]phenyl]-2-phenylbut-1-enyl]phenyl] cyclopropanecarboxylate (PubChem CID 67846798) has the molecular formula C31H35NO4 and a molecular weight of 485.62 g/mol. Its IUPAC name is [4-[1-[4-[3-(dimethylamino)-2-hydroxypropoxy]phenyl]-2-phenylbut-1-enyl]phenyl] cyclopropanecarboxylate.
| Compound Name | [4-[1-[4-[3-(dimethylamino)-2-hydroxypropoxy]phenyl]-2-phenylbut-1-enyl]phenyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 67846798 |
| Molecular Formula | C31H35NO4 |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | [4-[1-[4-[3-(dimethylamino)-2-hydroxypropoxy]phenyl]-2-phenylbut-1-enyl]phenyl] cyclopropanecarboxylate |
| SMILES | CCC(=C(c1ccc(OCC(O)CN(C)C)cc1)c1ccc(OC(=O)C2CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C31H35NO4/c1-4-29(22-8-6-5-7-9-22)30(24-14-18-28(19-15-24)36-31(34)25-10-11-25)23-12-16-27(17-13-23)35-21-26(33)20-32(2)3/h5-9,12-19,25-26,33H,4,10-11,20-21H2,1-3H3 |
| InChIKey | GUXMRVUOROPHRW-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|