C29H33NO2 — CID 67847123
1-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-3-pyrrolidin-1-ylpropan-2-ol (PubChem CID 67847123) has the molecular formula C29H33NO2 and a molecular weight of 427.59 g/mol. Its IUPAC name is 1-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-3-pyrrolidin-1-ylpropan-2-ol.
| Compound Name | 1-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-3-pyrrolidin-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 67847123 |
| Molecular Formula | C29H33NO2 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 1-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-3-pyrrolidin-1-ylpropan-2-ol |
| SMILES | CC/C(=C(\c1ccccc1)c1ccc(OCC(O)CN2CCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H33NO2/c1-2-28(23-11-5-3-6-12-23)29(24-13-7-4-8-14-24)25-15-17-27(18-16-25)32-22-26(31)21-30-19-9-10-20-30/h3-8,11-18,26,31H,2,9-10,19-22H2,1H3/b29-28- |
| InChIKey | IQWGUUUXOMUTSI-ZIADKAODSA-N |
| XLogP | 5.89 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|