C19H31NO2 — CID 2306304
(2R)-1-(azepan-1-yl)-3-(4-tert-butylphenoxy)propan-2-ol (PubChem CID 2306304) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is (2R)-1-(azepan-1-yl)-3-(4-tert-butylphenoxy)propan-2-ol.
| Compound Name | (2R)-1-(azepan-1-yl)-3-(4-tert-butylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 2306304 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | (2R)-1-(azepan-1-yl)-3-(4-tert-butylphenoxy)propan-2-ol |
| SMILES | CC(C)(C)c1ccc(OC[C@H](O)CN2CCCCCC2)cc1 |
| InChI | InChI=1S/C19H31NO2/c1-19(2,3)16-8-10-18(11-9-16)22-15-17(21)14-20-12-6-4-5-7-13-20/h8-11,17,21H,4-7,12-15H2,1-3H3/t17-/m1/s1 |
| InChIKey | SYTSDFJMWZSPFV-QGZVFWFLSA-N |
| XLogP | 3.60 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |