C23H30FNO4 — CID 121399577
(2R)-1-(aziridin-1-yl)-3-[4-[2-[4-[(2S)-3-fluoro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]propan-2-ol (PubChem CID 121399577) has the molecular formula C23H30FNO4 and a molecular weight of 403.49 g/mol. Its IUPAC name is (2R)-1-(aziridin-1-yl)-3-[4-[2-[4-[(2S)-3-fluoro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]propan-2-ol.
| Compound Name | (2R)-1-(aziridin-1-yl)-3-[4-[2-[4-[(2S)-3-fluoro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 121399577 |
| Molecular Formula | C23H30FNO4 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | (2R)-1-(aziridin-1-yl)-3-[4-[2-[4-[(2S)-3-fluoro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]propan-2-ol |
| SMILES | CC(C)(c1ccc(OC[C@H](O)CF)cc1)c1ccc(OC[C@H](O)CN2CC2)cc1 |
| InChI | InChI=1S/C23H30FNO4/c1-23(2,17-3-7-21(8-4-17)28-15-19(26)13-24)18-5-9-22(10-6-18)29-16-20(27)14-25-11-12-25/h3-10,19-20,26-27H,11-16H2,1-2H3/t19-,20-/m1/s1 |
| InChIKey | RXEDKJIUYOCQCM-WOJBJXKFSA-N |
| XLogP | 2.78 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|