C25H34ClNO4S — CID 135375916
(2S)-1-[4-[2-[4-[(2R)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]-3-thiomorpholin-4-ylpropan-2-ol (PubChem CID 135375916) has the molecular formula C25H34ClNO4S and a molecular weight of 480.07 g/mol. Its IUPAC name is (2S)-1-[4-[2-[4-[(2R)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]-3-thiomorpholin-4-ylpropan-2-ol.
| Compound Name | (2S)-1-[4-[2-[4-[(2R)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]-3-thiomorpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 135375916 |
| Molecular Formula | C25H34ClNO4S |
| Molecular Weight | 480.07 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | (2S)-1-[4-[2-[4-[(2R)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]-3-thiomorpholin-4-ylpropan-2-ol |
| SMILES | CC(C)(c1ccc(OC[C@@H](O)CN2CCSCC2)cc1)c1ccc(OC[C@@H](O)CCl)cc1 |
| InChI | InChI=1S/C25H34ClNO4S/c1-25(2,19-3-7-23(8-4-19)30-17-21(28)15-26)20-5-9-24(10-6-20)31-18-22(29)16-27-11-13-32-14-12-27/h3-10,21-22,28-29H,11-18H2,1-2H3/t21-,22-/m0/s1 |
| InChIKey | FYGNUSHTTLPCTQ-VXKWHMMOSA-N |
| XLogP | 3.78 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.07 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|