C21H29ClO5S — CID 158124726
3-[4-[2-[4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]propane-1,2-diol;sulfane (PubChem CID 158124726) has the molecular formula C21H29ClO5S and a molecular weight of 428.98 g/mol. Its IUPAC name is 3-[4-[2-[4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]propane-1,2-diol;sulfane.
| Compound Name | 3-[4-[2-[4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]propane-1,2-diol;sulfane |
|---|---|
| PubChem CID | 158124726 |
| Molecular Formula | C21H29ClO5S |
| Molecular Weight | 428.98 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 3-[4-[2-[4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]propane-1,2-diol;sulfane |
| SMILES | CC(C)(c1ccc(OCC(O)CO)cc1)c1ccc(OC[C@H](O)CCl)cc1.S |
| InChI | InChI=1S/C21H27ClO5.H2S/c1-21(2,15-3-7-19(8-4-15)26-13-17(24)11-22)16-5-9-20(10-6-16)27-14-18(25)12-23;/h3-10,17-18,23-25H,11-14H2,1-2H3;1H2/t17-,18?;/m1./s1 |
| InChIKey | FSAIBWSJJHTLEK-XRVQSCEISA-N |
| XLogP | 2.84 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.98 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|