C21H25ClO3S — CID 161389101
(2S)-1-chloro-3-[4-[2-(4-prop-2-ynoxyphenyl)propan-2-yl]phenoxy]propan-2-ol;sulfane (PubChem CID 161389101) has the molecular formula C21H25ClO3S and a molecular weight of 392.95 g/mol. Its IUPAC name is (2S)-1-chloro-3-[4-[2-(4-prop-2-ynoxyphenyl)propan-2-yl]phenoxy]propan-2-ol;sulfane.
| Compound Name | (2S)-1-chloro-3-[4-[2-(4-prop-2-ynoxyphenyl)propan-2-yl]phenoxy]propan-2-ol;sulfane |
|---|---|
| PubChem CID | 161389101 |
| Molecular Formula | C21H25ClO3S |
| Molecular Weight | 392.95 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | (2S)-1-chloro-3-[4-[2-(4-prop-2-ynoxyphenyl)propan-2-yl]phenoxy]propan-2-ol;sulfane |
| SMILES | C#CCOc1ccc(C(C)(C)c2ccc(OC[C@H](O)CCl)cc2)cc1.S |
| InChI | InChI=1S/C21H23ClO3.H2S/c1-4-13-24-19-9-5-16(6-10-19)21(2,3)17-7-11-20(12-8-17)25-15-18(23)14-22;/h1,5-12,18,23H,13-15H2,2-3H3;1H2/t18-;/m1./s1 |
| InChIKey | VSSYWLWQZLCFKY-GMUIIQOCSA-N |
| XLogP | 4.12 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.95 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|