C21H25ClF2O3 — CID 89406803
(2R)-1-chloro-3-[4-[2-[4-[(2S)-2,3-difluoropropoxy]phenyl]propan-2-yl]phenoxy]propan-2-ol (PubChem CID 89406803) has the molecular formula C21H25ClF2O3 and a molecular weight of 398.88 g/mol. Its IUPAC name is (2R)-1-chloro-3-[4-[2-[4-[(2S)-2,3-difluoropropoxy]phenyl]propan-2-yl]phenoxy]propan-2-ol.
| Compound Name | (2R)-1-chloro-3-[4-[2-[4-[(2S)-2,3-difluoropropoxy]phenyl]propan-2-yl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 89406803 |
| Molecular Formula | C21H25ClF2O3 |
| Molecular Weight | 398.88 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | (2R)-1-chloro-3-[4-[2-[4-[(2S)-2,3-difluoropropoxy]phenyl]propan-2-yl]phenoxy]propan-2-ol |
| SMILES | CC(C)(c1ccc(OC[C@@H](O)CCl)cc1)c1ccc(OC[C@H](F)CF)cc1 |
| InChI | InChI=1S/C21H25ClF2O3/c1-21(2,15-3-7-19(8-4-15)26-13-17(24)12-23)16-5-9-20(10-6-16)27-14-18(25)11-22/h3-10,17-18,25H,11-14H2,1-2H3/t17-,18+/m1/s1 |
| InChIKey | JKPYEGMKUDJOKA-MSOLQXFVSA-N |
| XLogP | 4.68 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.88 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|