C21H30Cl2O6 — CID 146158255
3-[4-[2-[4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]propane-1,2-diol;hydrate;hydrochloride (PubChem CID 146158255) has the molecular formula C21H30Cl2O6 and a molecular weight of 449.37 g/mol. Its IUPAC name is 3-[4-[2-[4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]propane-1,2-diol;hydrate;hydrochloride.
| Compound Name | 3-[4-[2-[4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]propane-1,2-diol;hydrate;hydrochloride |
|---|---|
| PubChem CID | 146158255 |
| Molecular Formula | C21H30Cl2O6 |
| Molecular Weight | 449.37 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 3-[4-[2-[4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]propane-1,2-diol;hydrate;hydrochloride |
| SMILES | CC(C)(c1ccc(OCC(O)CO)cc1)c1ccc(OCC(O)CCl)cc1.Cl.O |
| InChI | InChI=1S/C21H27ClO5.ClH.H2O/c1-21(2,15-3-7-19(8-4-15)26-13-17(24)11-22)16-5-9-20(10-6-16)27-14-18(25)12-23;;/h3-10,17-18,23-25H,11-14H2,1-2H3;1H;1H2 |
| InChIKey | JIXHVCGGCDQTNJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 110.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|