C21H30Cl2O5S2 — CID 160979184
(2S)-3-[4-[2-[3-chloro-4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]propane-1,2-diol;sulfane (PubChem CID 160979184) has the molecular formula C21H30Cl2O5S2 and a molecular weight of 497.51 g/mol. Its IUPAC name is (2S)-3-[4-[2-[3-chloro-4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]propane-1,2-diol;sulfane.
| Compound Name | (2S)-3-[4-[2-[3-chloro-4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]propane-1,2-diol;sulfane |
|---|---|
| PubChem CID | 160979184 |
| Molecular Formula | C21H30Cl2O5S2 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | (2S)-3-[4-[2-[3-chloro-4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]propane-1,2-diol;sulfane |
| SMILES | CC(C)(c1ccc(OC[C@@H](O)CO)cc1)c1ccc(OC[C@H](O)CCl)c(Cl)c1.S.S |
| InChI | InChI=1S/C21H26Cl2O5.2H2S/c1-21(2,14-3-6-18(7-4-14)27-13-17(26)11-24)15-5-8-20(19(23)9-15)28-12-16(25)10-22;;/h3-9,16-17,24-26H,10-13H2,1-2H3;2*1H2/t16-,17+;;/m1../s1 |
| InChIKey | SZHBQHPFVPPJEK-LWPKXAGOSA-N |
| XLogP | 3.60 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|