C22H27Cl3O4 — CID 170373534
1-chloro-3-[2-chloro-4-[2-[3-chloro-4-(3-methoxypropoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol (PubChem CID 170373534) has the molecular formula C22H27Cl3O4 and a molecular weight of 461.81 g/mol. Its IUPAC name is 1-chloro-3-[2-chloro-4-[2-[3-chloro-4-(3-methoxypropoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol.
| Compound Name | 1-chloro-3-[2-chloro-4-[2-[3-chloro-4-(3-methoxypropoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 170373534 |
| Molecular Formula | C22H27Cl3O4 |
| Molecular Weight | 461.81 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 1-chloro-3-[2-chloro-4-[2-[3-chloro-4-(3-methoxypropoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol |
| SMILES | COCCCOc1ccc(C(C)(C)c2ccc(OCC(O)CCl)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C22H27Cl3O4/c1-22(2,15-5-7-20(18(24)11-15)28-10-4-9-27-3)16-6-8-21(19(25)12-16)29-14-17(26)13-23/h5-8,11-12,17,26H,4,9-10,13-14H2,1-3H3 |
| InChIKey | YMXHSWLSWCKYHW-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.81 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|