C25H35Cl2N3O4 — CID 145119766
(Z)-2-amino-3-[amino-[3-[4-[2-[3-chloro-4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]propyl]amino]but-2-en-1-ol (PubChem CID 145119766) has the molecular formula C25H35Cl2N3O4 and a molecular weight of 512.48 g/mol. Its IUPAC name is (Z)-2-amino-3-[amino-[3-[4-[2-[3-chloro-4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]propyl]amino]but-2-en-1-ol.
| Compound Name | (Z)-2-amino-3-[amino-[3-[4-[2-[3-chloro-4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]propyl]amino]but-2-en-1-ol |
|---|---|
| PubChem CID | 145119766 |
| Molecular Formula | C25H35Cl2N3O4 |
| Molecular Weight | 512.48 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | (Z)-2-amino-3-[amino-[3-[4-[2-[3-chloro-4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]propyl]amino]but-2-en-1-ol |
| SMILES | C/C(=C(/N)CO)N(N)CCCOc1ccc(C(C)(C)c2ccc(OCC(O)CCl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C25H35Cl2N3O4/c1-17(23(28)15-31)30(29)11-4-12-33-21-8-5-18(6-9-21)25(2,3)19-7-10-24(22(27)13-19)34-16-20(32)14-26/h5-10,13,20,31-32H,4,11-12,14-16,28-29H2,1-3H3/b23-17- |
| InChIKey | NIMUXAOXYXJWAJ-QJOMJCCJSA-N |
| XLogP | 3.77 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|