C25H35Cl2N3O5 — CID 145119729
(Z)-3-amino-2-[amino-[3-[4-[2-[3-chloro-4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl]amino]but-2-en-1-ol (PubChem CID 145119729) has the molecular formula C25H35Cl2N3O5 and a molecular weight of 528.48 g/mol. Its IUPAC name is (Z)-3-amino-2-[amino-[3-[4-[2-[3-chloro-4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl]amino]but-2-en-1-ol.
| Compound Name | (Z)-3-amino-2-[amino-[3-[4-[2-[3-chloro-4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl]amino]but-2-en-1-ol |
|---|---|
| PubChem CID | 145119729 |
| Molecular Formula | C25H35Cl2N3O5 |
| Molecular Weight | 528.48 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | (Z)-3-amino-2-[amino-[3-[4-[2-[3-chloro-4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl]amino]but-2-en-1-ol |
| SMILES | C/C(N)=C(\CO)N(N)CC(O)COc1ccc(C(C)(C)c2ccc(OCC(O)CCl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C25H35Cl2N3O5/c1-16(28)23(13-31)30(29)12-20(33)15-34-21-7-4-17(5-8-21)25(2,3)18-6-9-24(22(27)10-18)35-14-19(32)11-26/h4-10,19-20,31-33H,11-15,28-29H2,1-3H3/b23-16- |
| InChIKey | NIZVBKKCQYUKAH-KQWNVCNZSA-N |
| XLogP | 2.74 |
| TPSA | 134.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|