C26H38ClN3O4 — CID 145119778
(Z)-2-amino-3-[amino-[3-[4-[2-[4-(3-chloropropoxy)-3-methylphenyl]propan-2-yl]phenoxy]-2-hydroxypropyl]amino]but-2-en-1-ol (PubChem CID 145119778) has the molecular formula C26H38ClN3O4 and a molecular weight of 492.06 g/mol. Its IUPAC name is (Z)-2-amino-3-[amino-[3-[4-[2-[4-(3-chloropropoxy)-3-methylphenyl]propan-2-yl]phenoxy]-2-hydroxypropyl]amino]but-2-en-1-ol.
| Compound Name | (Z)-2-amino-3-[amino-[3-[4-[2-[4-(3-chloropropoxy)-3-methylphenyl]propan-2-yl]phenoxy]-2-hydroxypropyl]amino]but-2-en-1-ol |
|---|---|
| PubChem CID | 145119778 |
| Molecular Formula | C26H38ClN3O4 |
| Molecular Weight | 492.06 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | (Z)-2-amino-3-[amino-[3-[4-[2-[4-(3-chloropropoxy)-3-methylphenyl]propan-2-yl]phenoxy]-2-hydroxypropyl]amino]but-2-en-1-ol |
| SMILES | C/C(=C(/N)CO)N(N)CC(O)COc1ccc(C(C)(C)c2ccc(OCCCCl)c(C)c2)cc1 |
| InChI | InChI=1S/C26H38ClN3O4/c1-18-14-21(8-11-25(18)33-13-5-12-27)26(3,4)20-6-9-23(10-7-20)34-17-22(32)15-30(29)19(2)24(28)16-31/h6-11,14,22,31-32H,5,12-13,15-17,28-29H2,1-4H3/b24-19- |
| InChIKey | RMLDQNIZGLAGGM-CLCOLTQESA-N |
| XLogP | 3.43 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.06 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|