C27H42ClN3O2 — CID 145119454
(Z)-1-[amino-[3-[4-[2-[4-(3-chloropropoxy)-3-methylphenyl]propan-2-yl]phenoxy]propyl]amino]prop-1-en-2-amine;ethane (PubChem CID 145119454) has the molecular formula C27H42ClN3O2 and a molecular weight of 476.11 g/mol. Its IUPAC name is (Z)-1-[amino-[3-[4-[2-[4-(3-chloropropoxy)-3-methylphenyl]propan-2-yl]phenoxy]propyl]amino]prop-1-en-2-amine;ethane.
| Compound Name | (Z)-1-[amino-[3-[4-[2-[4-(3-chloropropoxy)-3-methylphenyl]propan-2-yl]phenoxy]propyl]amino]prop-1-en-2-amine;ethane |
|---|---|
| PubChem CID | 145119454 |
| Molecular Formula | C27H42ClN3O2 |
| Molecular Weight | 476.11 g/mol |
| Exact Mass | 475.30 |
| IUPAC Name | (Z)-1-[amino-[3-[4-[2-[4-(3-chloropropoxy)-3-methylphenyl]propan-2-yl]phenoxy]propyl]amino]prop-1-en-2-amine;ethane |
| SMILES | C/C(N)=C/N(N)CCCOc1ccc(C(C)(C)c2ccc(OCCCCl)c(C)c2)cc1.CC |
| InChI | InChI=1S/C25H36ClN3O2.C2H6/c1-19-17-22(9-12-24(19)31-15-5-13-26)25(3,4)21-7-10-23(11-8-21)30-16-6-14-29(28)18-20(2)27;1-2/h7-12,17-18H,5-6,13-16,27-28H2,1-4H3;1-2H3/b20-18-; |
| InChIKey | RSWKPYNLDPWUMO-GQQUDWLYSA-N |
| XLogP | 6.12 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.11 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|