C29H48ClN3O3 — CID 145119732
(Z)-3-amino-2-[amino-[3-[4-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]propyl]amino]but-2-en-1-ol;ethane (PubChem CID 145119732) has the molecular formula C29H48ClN3O3 and a molecular weight of 522.17 g/mol. Its IUPAC name is (Z)-3-amino-2-[amino-[3-[4-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]propyl]amino]but-2-en-1-ol;ethane.
| Compound Name | (Z)-3-amino-2-[amino-[3-[4-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]propyl]amino]but-2-en-1-ol;ethane |
|---|---|
| PubChem CID | 145119732 |
| Molecular Formula | C29H48ClN3O3 |
| Molecular Weight | 522.17 g/mol |
| Exact Mass | 521.34 |
| IUPAC Name | (Z)-3-amino-2-[amino-[3-[4-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]propyl]amino]but-2-en-1-ol;ethane |
| SMILES | C/C(N)=C(\CO)N(N)CCCOc1ccc(C(C)(C)c2ccc(OCCCCl)cc2)cc1.CC.CC |
| InChI | InChI=1S/C25H36ClN3O3.2C2H6/c1-19(27)24(18-30)29(28)15-5-17-32-23-12-8-21(9-13-23)25(2,3)20-6-10-22(11-7-20)31-16-4-14-26;2*1-2/h6-13,30H,4-5,14-18,27-28H2,1-3H3;2*1-2H3/b24-19-;; |
| InChIKey | RGDSKFOEADCPKC-NABJOEGNSA-N |
| XLogP | 6.20 |
| TPSA | 93.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.17 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|