C27H42ClN3O5 — CID 145119684
(Z)-3-amino-2-[amino-[3-[4-[2-[4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl]amino]but-2-en-1-ol;ethane (PubChem CID 145119684) has the molecular formula C27H42ClN3O5 and a molecular weight of 524.10 g/mol. Its IUPAC name is (Z)-3-amino-2-[amino-[3-[4-[2-[4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl]amino]but-2-en-1-ol;ethane.
| Compound Name | (Z)-3-amino-2-[amino-[3-[4-[2-[4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl]amino]but-2-en-1-ol;ethane |
|---|---|
| PubChem CID | 145119684 |
| Molecular Formula | C27H42ClN3O5 |
| Molecular Weight | 524.10 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | (Z)-3-amino-2-[amino-[3-[4-[2-[4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl]amino]but-2-en-1-ol;ethane |
| SMILES | C/C(N)=C(\CO)N(N)CC(O)COc1ccc(C(C)(C)c2ccc(OCC(O)CCl)cc2)cc1.CC |
| InChI | InChI=1S/C25H36ClN3O5.C2H6/c1-17(27)24(14-30)29(28)13-21(32)16-34-23-10-6-19(7-11-23)25(2,3)18-4-8-22(9-5-18)33-15-20(31)12-26;1-2/h4-11,20-21,30-32H,12-16,27-28H2,1-3H3;1-2H3/b24-17-; |
| InChIKey | OVQGZUANXDLZCK-IJVOEZGUSA-N |
| XLogP | 3.12 |
| TPSA | 134.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.10 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|