C25H34BrClIN3O5 — CID 145119771
(E)-2-[amino-[(2S)-3-[4-[2-[3-bromo-4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl]amino]-3-iodo-3-(methylamino)prop-2-en-1-ol (PubChem CID 145119771) has the molecular formula C25H34BrClIN3O5 and a molecular weight of 698.82 g/mol. Its IUPAC name is (E)-2-[amino-[(2S)-3-[4-[2-[3-bromo-4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl]amino]-3-iodo-3-(methylamino)prop-2-en-1-ol.
| Compound Name | (E)-2-[amino-[(2S)-3-[4-[2-[3-bromo-4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl]amino]-3-iodo-3-(methylamino)prop-2-en-1-ol |
|---|---|
| PubChem CID | 145119771 |
| Molecular Formula | C25H34BrClIN3O5 |
| Molecular Weight | 698.82 g/mol |
| Exact Mass | 697.04 |
| IUPAC Name | (E)-2-[amino-[(2S)-3-[4-[2-[3-bromo-4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl]amino]-3-iodo-3-(methylamino)prop-2-en-1-ol |
| SMILES | CN/C(I)=C(/CO)N(N)C[C@H](O)COc1ccc(C(C)(C)c2ccc(OC[C@H](O)CCl)c(Br)c2)cc1 |
| InChI | InChI=1S/C25H34BrClIN3O5/c1-25(2,17-6-9-23(21(26)10-17)36-14-18(33)11-27)16-4-7-20(8-5-16)35-15-19(34)12-31(29)22(13-32)24(28)30-3/h4-10,18-19,30,32-34H,11-15,29H2,1-3H3/b24-22-/t18-,19+/m1/s1 |
| InChIKey | VABRBZUKCXDKEE-VTHCQSLJSA-N |
| XLogP | 3.48 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.82 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|