C22H29ClO5 — CID 118052693
(2S)-3-[4-[2-[4-[(2R)-3-chloro-2-hydroxypropoxy]-3-methylphenyl]propan-2-yl]phenoxy]propane-1,2-diol (PubChem CID 118052693) has the molecular formula C22H29ClO5 and a molecular weight of 408.92 g/mol. Its IUPAC name is (2S)-3-[4-[2-[4-[(2R)-3-chloro-2-hydroxypropoxy]-3-methylphenyl]propan-2-yl]phenoxy]propane-1,2-diol.
| Compound Name | (2S)-3-[4-[2-[4-[(2R)-3-chloro-2-hydroxypropoxy]-3-methylphenyl]propan-2-yl]phenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 118052693 |
| Molecular Formula | C22H29ClO5 |
| Molecular Weight | 408.92 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | (2S)-3-[4-[2-[4-[(2R)-3-chloro-2-hydroxypropoxy]-3-methylphenyl]propan-2-yl]phenoxy]propane-1,2-diol |
| SMILES | Cc1cc(C(C)(C)c2ccc(OC[C@@H](O)CO)cc2)ccc1OC[C@@H](O)CCl |
| InChI | InChI=1S/C22H29ClO5/c1-15-10-17(6-9-21(15)28-13-18(25)11-23)22(2,3)16-4-7-20(8-5-16)27-14-19(26)12-24/h4-10,18-19,24-26H,11-14H2,1-3H3/t18-,19-/m0/s1 |
| InChIKey | NJLDNZLZBOZNAF-OALUTQOASA-N |
| XLogP | 3.03 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.92 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|