C22H29ClO4 — CID 89411073
(2R)-3-[4-[2-[4-[(2S)-3-chloro-2-methylpropoxy]phenyl]propan-2-yl]phenoxy]propane-1,2-diol (PubChem CID 89411073) has the molecular formula C22H29ClO4 and a molecular weight of 392.92 g/mol. Its IUPAC name is (2R)-3-[4-[2-[4-[(2S)-3-chloro-2-methylpropoxy]phenyl]propan-2-yl]phenoxy]propane-1,2-diol.
| Compound Name | (2R)-3-[4-[2-[4-[(2S)-3-chloro-2-methylpropoxy]phenyl]propan-2-yl]phenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 89411073 |
| Molecular Formula | C22H29ClO4 |
| Molecular Weight | 392.92 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | (2R)-3-[4-[2-[4-[(2S)-3-chloro-2-methylpropoxy]phenyl]propan-2-yl]phenoxy]propane-1,2-diol |
| SMILES | C[C@H](CCl)COc1ccc(C(C)(C)c2ccc(OC[C@H](O)CO)cc2)cc1 |
| InChI | InChI=1S/C22H29ClO4/c1-16(12-23)14-26-20-8-4-17(5-9-20)22(2,3)18-6-10-21(11-7-18)27-15-19(25)13-24/h4-11,16,19,24-25H,12-15H2,1-3H3/t16-,19-/m1/s1 |
| InChIKey | LLTFZOKVBINYHX-VQIMIIECSA-N |
| XLogP | 4.00 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.92 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|