C25H31ClIN3O4 — CID 162032939
(2R)-1-[4-[2-[4-[(2R)-3-chloro-2-methylpropoxy]phenyl]propan-2-yl]phenoxy]-3-[5-(hydroxymethyl)-4-(123I)iodotriazol-1-yl]propan-2-ol (PubChem CID 162032939) has the molecular formula C25H31ClIN3O4 and a molecular weight of 595.90 g/mol. Its IUPAC name is (2R)-1-[4-[2-[4-[(2R)-3-chloro-2-methylpropoxy]phenyl]propan-2-yl]phenoxy]-3-[5-(hydroxymethyl)-4-(123I)iodotriazol-1-yl]propan-2-ol.
| Compound Name | (2R)-1-[4-[2-[4-[(2R)-3-chloro-2-methylpropoxy]phenyl]propan-2-yl]phenoxy]-3-[5-(hydroxymethyl)-4-(123I)iodotriazol-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 162032939 |
| Molecular Formula | C25H31ClIN3O4 |
| Molecular Weight | 595.90 g/mol |
| Exact Mass | 595.11 |
| IUPAC Name | (2R)-1-[4-[2-[4-[(2R)-3-chloro-2-methylpropoxy]phenyl]propan-2-yl]phenoxy]-3-[5-(hydroxymethyl)-4-(123I)iodotriazol-1-yl]propan-2-ol |
| SMILES | C[C@@H](CCl)COc1ccc(C(C)(C)c2ccc(OC[C@H](O)Cn3nnc([123I])c3CO)cc2)cc1 |
| InChI | InChI=1S/C25H31ClIN3O4/c1-17(12-26)15-33-21-8-4-18(5-9-21)25(2,3)19-6-10-22(11-7-19)34-16-20(32)13-30-23(14-31)24(27)28-29-30/h4-11,17,20,31-32H,12-16H2,1-3H3/t17-,20+/m0/s1/i27-4 |
| InChIKey | KKYDPGHNMYVLHX-NPWHEWHRSA-N |
| XLogP | 4.39 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.90 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|