C24H29ClIN3O5 — CID 140941943
1-[4-[2-[4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-3-[5-(hydroxymethyl)-4-(123I)iodotriazol-1-yl]propan-2-ol (PubChem CID 140941943) has the molecular formula C24H29ClIN3O5 and a molecular weight of 597.87 g/mol. Its IUPAC name is 1-[4-[2-[4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-3-[5-(hydroxymethyl)-4-(123I)iodotriazol-1-yl]propan-2-ol.
| Compound Name | 1-[4-[2-[4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-3-[5-(hydroxymethyl)-4-(123I)iodotriazol-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 140941943 |
| Molecular Formula | C24H29ClIN3O5 |
| Molecular Weight | 597.87 g/mol |
| Exact Mass | 597.09 |
| IUPAC Name | 1-[4-[2-[4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-3-[5-(hydroxymethyl)-4-(123I)iodotriazol-1-yl]propan-2-ol |
| SMILES | CC(C)(c1ccc(OCC(O)CCl)cc1)c1ccc(OCC(O)Cn2nnc([123I])c2CO)cc1 |
| InChI | InChI=1S/C24H29ClIN3O5/c1-24(2,16-3-7-20(8-4-16)33-14-18(31)11-25)17-5-9-21(10-6-17)34-15-19(32)12-29-22(13-30)23(26)27-28-29/h3-10,18-19,30-32H,11-15H2,1-2H3/i26-4 |
| InChIKey | BFGBWFKGFLCPBK-QCAIBXFOSA-N |
| XLogP | 3.12 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.87 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|