C25H31ClO4 — CID 90381403
(2R)-1-[4-[2-[4-[(2R)-3-chloro-2-methylpropoxy]phenyl]propan-2-yl]phenoxy]-3-prop-2-ynoxypropan-2-ol (PubChem CID 90381403) has the molecular formula C25H31ClO4 and a molecular weight of 430.97 g/mol. Its IUPAC name is (2R)-1-[4-[2-[4-[(2R)-3-chloro-2-methylpropoxy]phenyl]propan-2-yl]phenoxy]-3-prop-2-ynoxypropan-2-ol.
| Compound Name | (2R)-1-[4-[2-[4-[(2R)-3-chloro-2-methylpropoxy]phenyl]propan-2-yl]phenoxy]-3-prop-2-ynoxypropan-2-ol |
|---|---|
| PubChem CID | 90381403 |
| Molecular Formula | C25H31ClO4 |
| Molecular Weight | 430.97 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | (2R)-1-[4-[2-[4-[(2R)-3-chloro-2-methylpropoxy]phenyl]propan-2-yl]phenoxy]-3-prop-2-ynoxypropan-2-ol |
| SMILES | C#CCOC[C@@H](O)COc1ccc(C(C)(C)c2ccc(OC[C@@H](C)CCl)cc2)cc1 |
| InChI | InChI=1S/C25H31ClO4/c1-5-14-28-17-22(27)18-30-24-12-8-21(9-13-24)25(3,4)20-6-10-23(11-7-20)29-16-19(2)15-26/h1,6-13,19,22,27H,14-18H2,2-4H3/t19-,22+/m0/s1 |
| InChIKey | QQTSGOKFWFREBR-SIKLNZKXSA-N |
| XLogP | 4.66 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.97 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|