C25H31ClO5 — CID 123951760
1-chloro-3-[4-[2-[4-(2-methoxy-3-prop-2-ynoxypropoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol (PubChem CID 123951760) has the molecular formula C25H31ClO5 and a molecular weight of 446.97 g/mol. Its IUPAC name is 1-chloro-3-[4-[2-[4-(2-methoxy-3-prop-2-ynoxypropoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol.
| Compound Name | 1-chloro-3-[4-[2-[4-(2-methoxy-3-prop-2-ynoxypropoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 123951760 |
| Molecular Formula | C25H31ClO5 |
| Molecular Weight | 446.97 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 1-chloro-3-[4-[2-[4-(2-methoxy-3-prop-2-ynoxypropoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol |
| SMILES | C#CCOCC(COc1ccc(C(C)(C)c2ccc(OCC(O)CCl)cc2)cc1)OC |
| InChI | InChI=1S/C25H31ClO5/c1-5-14-29-17-24(28-4)18-31-23-12-8-20(9-13-23)25(2,3)19-6-10-22(11-7-19)30-16-21(27)15-26/h1,6-13,21,24,27H,14-18H2,2-4H3 |
| InChIKey | YIIDFEVMOGLSQC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.97 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|