C22H25ClO5 — CID 66562991
(2R)-1-[4-[[4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]methyl]phenoxy]-3-prop-2-ynoxypropan-2-ol (PubChem CID 66562991) has the molecular formula C22H25ClO5 and a molecular weight of 404.89 g/mol. Its IUPAC name is (2R)-1-[4-[[4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]methyl]phenoxy]-3-prop-2-ynoxypropan-2-ol.
| Compound Name | (2R)-1-[4-[[4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]methyl]phenoxy]-3-prop-2-ynoxypropan-2-ol |
|---|---|
| PubChem CID | 66562991 |
| Molecular Formula | C22H25ClO5 |
| Molecular Weight | 404.89 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | (2R)-1-[4-[[4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]methyl]phenoxy]-3-prop-2-ynoxypropan-2-ol |
| SMILES | C#CCOC[C@@H](O)COc1ccc(Cc2ccc(OC[C@H](O)CCl)cc2)cc1 |
| InChI | InChI=1S/C22H25ClO5/c1-2-11-26-14-20(25)16-28-22-9-5-18(6-10-22)12-17-3-7-21(8-4-17)27-15-19(24)13-23/h1,3-10,19-20,24-25H,11-16H2/t19-,20-/m1/s1 |
| InChIKey | WURXVZWBPPTOKB-WOJBJXKFSA-N |
| XLogP | 2.65 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.89 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|