C18H20Cl2O4S — CID 53311158
1-chloro-3-[4-[4-(3-chloro-2-hydroxypropoxy)phenyl]sulfanylphenoxy]propan-2-ol (PubChem CID 53311158) has the molecular formula C18H20Cl2O4S and a molecular weight of 403.33 g/mol. Its IUPAC name is 1-chloro-3-[4-[4-(3-chloro-2-hydroxypropoxy)phenyl]sulfanylphenoxy]propan-2-ol.
| Compound Name | 1-chloro-3-[4-[4-(3-chloro-2-hydroxypropoxy)phenyl]sulfanylphenoxy]propan-2-ol |
|---|---|
| PubChem CID | 53311158 |
| Molecular Formula | C18H20Cl2O4S |
| Molecular Weight | 403.33 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 1-chloro-3-[4-[4-(3-chloro-2-hydroxypropoxy)phenyl]sulfanylphenoxy]propan-2-ol |
| SMILES | OC(CCl)COc1ccc(Sc2ccc(OCC(O)CCl)cc2)cc1 |
| InChI | InChI=1S/C18H20Cl2O4S/c19-9-13(21)11-23-15-1-5-17(6-2-15)25-18-7-3-16(4-8-18)24-12-14(22)10-20/h1-8,13-14,21-22H,9-12H2 |
| InChIKey | GVANGGPOOVWKKG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|