C19H20Cl2O5 — CID 53311159
bis[4-[(2R)-3-chloro-2-hydroxypropoxy]phenyl]methanone (PubChem CID 53311159) has the molecular formula C19H20Cl2O5 and a molecular weight of 399.27 g/mol. Its IUPAC name is bis[4-[(2R)-3-chloro-2-hydroxypropoxy]phenyl]methanone.
| Compound Name | bis[4-[(2R)-3-chloro-2-hydroxypropoxy]phenyl]methanone |
|---|---|
| PubChem CID | 53311159 |
| Molecular Formula | C19H20Cl2O5 |
| Molecular Weight | 399.27 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | bis[4-[(2R)-3-chloro-2-hydroxypropoxy]phenyl]methanone |
| SMILES | O=C(c1ccc(OC[C@@H](O)CCl)cc1)c1ccc(OC[C@@H](O)CCl)cc1 |
| InChI | InChI=1S/C19H20Cl2O5/c20-9-15(22)11-25-17-5-1-13(2-6-17)19(24)14-3-7-18(8-4-14)26-12-16(23)10-21/h1-8,15-16,22-23H,9-12H2/t15-,16-/m0/s1 |
| InChIKey | ZXDFVZDIXRYEHA-HOTGVXAUSA-N |
| XLogP | 2.87 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|