C27H30O9 — CID 141091325
[3-[4-[4-(3-but-2-enoyloxy-2-hydroxypropoxy)benzoyl]phenoxy]-2-hydroxypropyl] but-2-enoate (PubChem CID 141091325) has the molecular formula C27H30O9 and a molecular weight of 498.53 g/mol. Its IUPAC name is [3-[4-[4-(3-but-2-enoyloxy-2-hydroxypropoxy)benzoyl]phenoxy]-2-hydroxypropyl] but-2-enoate.
| Compound Name | [3-[4-[4-(3-but-2-enoyloxy-2-hydroxypropoxy)benzoyl]phenoxy]-2-hydroxypropyl] but-2-enoate |
|---|---|
| PubChem CID | 141091325 |
| Molecular Formula | C27H30O9 |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | [3-[4-[4-(3-but-2-enoyloxy-2-hydroxypropoxy)benzoyl]phenoxy]-2-hydroxypropyl] but-2-enoate |
| SMILES | CC=CC(=O)OCC(O)COc1ccc(C(=O)c2ccc(OCC(O)COC(=O)C=CC)cc2)cc1 |
| InChI | InChI=1S/C27H30O9/c1-3-5-25(30)35-17-21(28)15-33-23-11-7-19(8-12-23)27(32)20-9-13-24(14-10-20)34-16-22(29)18-36-26(31)6-4-2/h3-14,21-22,28-29H,15-18H2,1-2H3 |
| InChIKey | GJJGKWFWFQSTNG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|