About [3-[4-[(Z,2E)-2-ethylidenepent-3-enoyl]phenoxy]-2-hydroxypropyl] 5-methyl-4-oxohexanoate
[3-[4-[(Z,2E)-2-ethylidenepent-3-enoyl]phenoxy]-2-hydroxypropyl] 5-methyl-4-oxohexanoate (PubChem CID 166979121) has the molecular formula C23H30O6
and a molecular weight of 402.49 g/mol. Its IUPAC name is [3-[4-[(Z,2E)-2-ethylidenepent-3-enoyl]phenoxy]-2-hydroxypropyl] 5-methyl-4-oxohexanoate.
Molecular Properties
| Compound Name | [3-[4-[(Z,2E)-2-ethylidenepent-3-enoyl]phenoxy]-2-hydroxypropyl] 5-methyl-4-oxohexanoate |
| PubChem CID | 166979121 |
| Molecular Formula | C23H30O6 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | [3-[4-[(Z,2E)-2-ethylidenepent-3-enoyl]phenoxy]-2-hydroxypropyl] 5-methyl-4-oxohexanoate |
| SMILES | C/C=C\C(=C/C)C(=O)c1ccc(OCC(O)COC(=O)CCC(=O)C(C)C)cc1 |
| InChI | InChI=1S/C23H30O6/c1-5-7-17(6-2)23(27)18-8-10-20(11-9-18)28-14-19(24)15-29-22(26)13-12-21(25)16(3)4/h5-11,16,19,24H,12-15H2,1-4H3/b7-5-,17-6+ |
| InChIKey | BQQOZRQHYKTHDT-APZVSDDJSA-N |
| XLogP | 3.68 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [3-[4-[(Z,2E)-2-ethylidenepent-3-enoyl]phenoxy]-2-hydroxypropyl] 5-methyl-4-oxohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[4-[(Z,2E)-2-ethylidenepent-3-enoyl]phenoxy]-2-hydroxypropyl] 5-methyl-4-oxohexanoate?
The IUPAC name of [3-[4-[(Z,2E)-2-ethylidenepent-3-enoyl]phenoxy]-2-hydroxypropyl] 5-methyl-4-oxohexanoate (CID 166979121) is [3-[4-[(Z,2E)-2-ethylidenepent-3-enoyl]phenoxy]-2-hydroxypropyl] 5-methyl-4-oxohexanoate.
What is the SMILES notation for [3-[4-[(Z,2E)-2-ethylidenepent-3-enoyl]phenoxy]-2-hydroxypropyl] 5-methyl-4-oxohexanoate?
The canonical SMILES for [3-[4-[(Z,2E)-2-ethylidenepent-3-enoyl]phenoxy]-2-hydroxypropyl] 5-methyl-4-oxohexanoate is C/C=C\C(=C/C)C(=O)c1ccc(OCC(O)COC(=O)CCC(=O)C(C)C)cc1.
What is the InChIKey of [3-[4-[(Z,2E)-2-ethylidenepent-3-enoyl]phenoxy]-2-hydroxypropyl] 5-methyl-4-oxohexanoate?
The InChIKey is BQQOZRQHYKTHDT-APZVSDDJSA-N. The full InChI is InChI=1S/C23H30O6/c1-5-7-17(6-2)23(27)18-8-10-20(11-9-18)28-14-19(24)15-29-22(26)13-12-21(25)16(3)4/h5-11,16,19,24H,12-15H2,1-4H3/b7-5-,17-6+.
What are the key properties of [3-[4-[(Z,2E)-2-ethylidenepent-3-enoyl]phenoxy]-2-hydroxypropyl] 5-methyl-4-oxohexanoate?
[3-[4-[(Z,2E)-2-ethylidenepent-3-enoyl]phenoxy]-2-hydroxypropyl] 5-methyl-4-oxohexanoate has a molecular weight of 402.49 g/mol, XLogP of 3.68, 12 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[4-[(Z,2E)-2-ethylidenepent-3-enoyl]phenoxy]-2-hydroxypropyl] 5-methyl-4-oxohexanoate is sourced from PubChem (CID 166979121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).