C23H30O6 — CID 166979121
[3-[4-[(Z,2E)-2-ethylidenepent-3-enoyl]phenoxy]-2-hydroxypropyl] 5-methyl-4-oxohexanoate (PubChem CID 166979121) has the molecular formula C23H30O6 and a molecular weight of 402.49 g/mol. Its IUPAC name is [3-[4-[(Z,2E)-2-ethylidenepent-3-enoyl]phenoxy]-2-hydroxypropyl] 5-methyl-4-oxohexanoate.
| Compound Name | [3-[4-[(Z,2E)-2-ethylidenepent-3-enoyl]phenoxy]-2-hydroxypropyl] 5-methyl-4-oxohexanoate |
|---|---|
| PubChem CID | 166979121 |
| Molecular Formula | C23H30O6 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | [3-[4-[(Z,2E)-2-ethylidenepent-3-enoyl]phenoxy]-2-hydroxypropyl] 5-methyl-4-oxohexanoate |
| SMILES | C/C=C\C(=C/C)C(=O)c1ccc(OCC(O)COC(=O)CCC(=O)C(C)C)cc1 |
| InChI | InChI=1S/C23H30O6/c1-5-7-17(6-2)23(27)18-8-10-20(11-9-18)28-14-19(24)15-29-22(26)13-12-21(25)16(3)4/h5-11,16,19,24H,12-15H2,1-4H3/b7-5-,17-6+ |
| InChIKey | BQQOZRQHYKTHDT-APZVSDDJSA-N |
| XLogP | 3.68 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|