C19H30O4 — CID 165377990
[3-(4-tert-butylphenoxy)-2-hydroxypropyl] 4-methylpentanoate (PubChem CID 165377990) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is [3-(4-tert-butylphenoxy)-2-hydroxypropyl] 4-methylpentanoate.
| Compound Name | [3-(4-tert-butylphenoxy)-2-hydroxypropyl] 4-methylpentanoate |
|---|---|
| PubChem CID | 165377990 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | [3-(4-tert-butylphenoxy)-2-hydroxypropyl] 4-methylpentanoate |
| SMILES | CC(C)CCC(=O)OCC(O)COc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H30O4/c1-14(2)6-11-18(21)23-13-16(20)12-22-17-9-7-15(8-10-17)19(3,4)5/h7-10,14,16,20H,6,11-13H2,1-5H3 |
| InChIKey | ACHOKEQSVQEJKB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |