C20H24O4 — CID 122466220
(2-hydroxy-3-phenoxypropyl) 4-tert-butylbenzoate (PubChem CID 122466220) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is (2-hydroxy-3-phenoxypropyl) 4-tert-butylbenzoate.
| Compound Name | (2-hydroxy-3-phenoxypropyl) 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 122466220 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (2-hydroxy-3-phenoxypropyl) 4-tert-butylbenzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)OCC(O)COc2ccccc2)cc1 |
| InChI | InChI=1S/C20H24O4/c1-20(2,3)16-11-9-15(10-12-16)19(22)24-14-17(21)13-23-18-7-5-4-6-8-18/h4-12,17,21H,13-14H2,1-3H3 |
| InChIKey | DBVSRIRVJCLNMY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |