C16H14Br2O5 — CID 59017835
(2-hydroxy-3-phenoxypropyl) 3,5-dibromo-4-hydroxybenzoate (PubChem CID 59017835) has the molecular formula C16H14Br2O5 and a molecular weight of 446.09 g/mol. Its IUPAC name is (2-hydroxy-3-phenoxypropyl) 3,5-dibromo-4-hydroxybenzoate.
| Compound Name | (2-hydroxy-3-phenoxypropyl) 3,5-dibromo-4-hydroxybenzoate |
|---|---|
| PubChem CID | 59017835 |
| Molecular Formula | C16H14Br2O5 |
| Molecular Weight | 446.09 g/mol |
| Exact Mass | 443.92 |
| IUPAC Name | (2-hydroxy-3-phenoxypropyl) 3,5-dibromo-4-hydroxybenzoate |
| SMILES | O=C(OCC(O)COc1ccccc1)c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C16H14Br2O5/c17-13-6-10(7-14(18)15(13)20)16(21)23-9-11(19)8-22-12-4-2-1-3-5-12/h1-7,11,19-20H,8-9H2 |
| InChIKey | NHLYFFXFWJYKSS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.09 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |