C26H28O10 — CID 163809013
[2-hydroxy-3-[4-[4-(2-hydroxy-3-methoxypropoxy)phenyl]phenoxy]propyl] 3,4,5-trihydroxybenzoate (PubChem CID 163809013) has the molecular formula C26H28O10 and a molecular weight of 500.50 g/mol. Its IUPAC name is [2-hydroxy-3-[4-[4-(2-hydroxy-3-methoxypropoxy)phenyl]phenoxy]propyl] 3,4,5-trihydroxybenzoate.
| Compound Name | [2-hydroxy-3-[4-[4-(2-hydroxy-3-methoxypropoxy)phenyl]phenoxy]propyl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 163809013 |
| Molecular Formula | C26H28O10 |
| Molecular Weight | 500.50 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | [2-hydroxy-3-[4-[4-(2-hydroxy-3-methoxypropoxy)phenyl]phenoxy]propyl] 3,4,5-trihydroxybenzoate |
| SMILES | COCC(O)COc1ccc(-c2ccc(OCC(O)COC(=O)c3cc(O)c(O)c(O)c3)cc2)cc1 |
| InChI | InChI=1S/C26H28O10/c1-33-12-19(27)13-34-21-6-2-16(3-7-21)17-4-8-22(9-5-17)35-14-20(28)15-36-26(32)18-10-23(29)25(31)24(30)11-18/h2-11,19-20,27-31H,12-15H2,1H3 |
| InChIKey | KYXLKSDJCDOXQC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 155.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.50 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|