C32H30O16S — CID 163571118
[2-hydroxy-3-[4-[4-[2-hydroxy-3-(3,4,5-trihydroxybenzoyl)oxypropoxy]phenyl]sulfonylphenoxy]propyl] 3,4,5-trihydroxybenzoate (PubChem CID 163571118) has the molecular formula C32H30O16S and a molecular weight of 702.64 g/mol. Its IUPAC name is [2-hydroxy-3-[4-[4-[2-hydroxy-3-(3,4,5-trihydroxybenzoyl)oxypropoxy]phenyl]sulfonylphenoxy]propyl] 3,4,5-trihydroxybenzoate.
| Compound Name | [2-hydroxy-3-[4-[4-[2-hydroxy-3-(3,4,5-trihydroxybenzoyl)oxypropoxy]phenyl]sulfonylphenoxy]propyl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 163571118 |
| Molecular Formula | C32H30O16S |
| Molecular Weight | 702.64 g/mol |
| Exact Mass | 702.13 |
| IUPAC Name | [2-hydroxy-3-[4-[4-[2-hydroxy-3-(3,4,5-trihydroxybenzoyl)oxypropoxy]phenyl]sulfonylphenoxy]propyl] 3,4,5-trihydroxybenzoate |
| SMILES | O=C(OCC(O)COc1ccc(S(=O)(=O)c2ccc(OCC(O)COC(=O)c3cc(O)c(O)c(O)c3)cc2)cc1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C32H30O16S/c33-19(15-47-31(41)17-9-25(35)29(39)26(36)10-17)13-45-21-1-5-23(6-2-21)49(43,44)24-7-3-22(4-8-24)46-14-20(34)16-48-32(42)18-11-27(37)30(40)28(38)12-18/h1-12,19-20,33-40H,13-16H2 |
| InChIKey | FZKNXLUAOCRLOL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 267.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.64 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|