C36H35O8PS — CID 87482724
2-hydroxyethyl(triphenyl)phosphanium;3-(2-hydroxy-3-phenoxypropoxy)carbonylbenzenesulfonate (PubChem CID 87482724) has the molecular formula C36H35O8PS and a molecular weight of 658.71 g/mol. Its IUPAC name is 2-hydroxyethyl(triphenyl)phosphanium;3-(2-hydroxy-3-phenoxypropoxy)carbonylbenzenesulfonate.
| Compound Name | 2-hydroxyethyl(triphenyl)phosphanium;3-(2-hydroxy-3-phenoxypropoxy)carbonylbenzenesulfonate |
|---|---|
| PubChem CID | 87482724 |
| Molecular Formula | C36H35O8PS |
| Molecular Weight | 658.71 g/mol |
| Exact Mass | 658.18 |
| IUPAC Name | 2-hydroxyethyl(triphenyl)phosphanium;3-(2-hydroxy-3-phenoxypropoxy)carbonylbenzenesulfonate |
| SMILES | O=C(OCC(O)COc1ccccc1)c1cccc(S(=O)(=O)[O-])c1.OCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H20OP.C16H16O7S/c21-16-17-22(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20;17-13(10-22-14-6-2-1-3-7-14)11-23-16(18)12-5-4-8-15(9-12)24(19,20)21/h1-15,21H,16-17H2;1-9,13,17H,10-11H2,(H,19,20,21)/q+1;/p-1 |
| InChIKey | XZIJWIDVFLZKLL-UHFFFAOYSA-M |
| XLogP | 4.16 |
| TPSA | 133.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.71 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|