C30H31O7PS — CID 87481708
2-hydroxyethyl(triphenyl)phosphanium;4-(2-hydroxypropoxycarbonyl)benzenesulfonate (PubChem CID 87481708) has the molecular formula C30H31O7PS and a molecular weight of 566.61 g/mol. Its IUPAC name is 2-hydroxyethyl(triphenyl)phosphanium;4-(2-hydroxypropoxycarbonyl)benzenesulfonate.
| Compound Name | 2-hydroxyethyl(triphenyl)phosphanium;4-(2-hydroxypropoxycarbonyl)benzenesulfonate |
|---|---|
| PubChem CID | 87481708 |
| Molecular Formula | C30H31O7PS |
| Molecular Weight | 566.61 g/mol |
| Exact Mass | 566.15 |
| IUPAC Name | 2-hydroxyethyl(triphenyl)phosphanium;4-(2-hydroxypropoxycarbonyl)benzenesulfonate |
| SMILES | CC(O)COC(=O)c1ccc(S(=O)(=O)[O-])cc1.OCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H20OP.C10H12O6S/c21-16-17-22(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20;1-7(11)6-16-10(12)8-2-4-9(5-3-8)17(13,14)15/h1-15,21H,16-17H2;2-5,7,11H,6H2,1H3,(H,13,14,15)/q+1;/p-1 |
| InChIKey | VCZZHZYUPQFWMA-UHFFFAOYSA-M |
| XLogP | 3.10 |
| TPSA | 123.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.61 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|