C31H31O9PS — CID 159582931
3,5-bis(2-hydroxyethoxycarbonyl)benzenesulfonate;methyl(triphenyl)phosphanium (PubChem CID 159582931) has the molecular formula C31H31O9PS and a molecular weight of 610.62 g/mol. Its IUPAC name is 3,5-bis(2-hydroxyethoxycarbonyl)benzenesulfonate;methyl(triphenyl)phosphanium.
| Compound Name | 3,5-bis(2-hydroxyethoxycarbonyl)benzenesulfonate;methyl(triphenyl)phosphanium |
|---|---|
| PubChem CID | 159582931 |
| Molecular Formula | C31H31O9PS |
| Molecular Weight | 610.62 g/mol |
| Exact Mass | 610.14 |
| IUPAC Name | 3,5-bis(2-hydroxyethoxycarbonyl)benzenesulfonate;methyl(triphenyl)phosphanium |
| SMILES | C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.O=C(OCCO)c1cc(C(=O)OCCO)cc(S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C19H18P.C12H14O9S/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;13-1-3-20-11(15)8-5-9(12(16)21-4-2-14)7-10(6-8)22(17,18)19/h2-16H,1H3;5-7,13-14H,1-4H2,(H,17,18,19)/q+1;/p-1 |
| InChIKey | MJGATYKGXQGUJD-UHFFFAOYSA-M |
| XLogP | 2.50 |
| TPSA | 150.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.62 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|