C10H9KO8S — CID 141132154
potassium 3-(2-hydroxyethoxycarbonyl)-5-sulfobenzoate (PubChem CID 141132154) has the molecular formula C10H9KO8S and a molecular weight of 328.34 g/mol. Its IUPAC name is potassium 3-(2-hydroxyethoxycarbonyl)-5-sulfobenzoate.
| Compound Name | potassium 3-(2-hydroxyethoxycarbonyl)-5-sulfobenzoate |
|---|---|
| PubChem CID | 141132154 |
| Molecular Formula | C10H9KO8S |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 327.97 |
| IUPAC Name | potassium 3-(2-hydroxyethoxycarbonyl)-5-sulfobenzoate |
| SMILES | O=C([O-])c1cc(C(=O)OCCO)cc(S(=O)(=O)O)c1.[K+] |
| InChI | InChI=1S/C10H10O8S.K/c11-1-2-18-10(14)7-3-6(9(12)13)4-8(5-7)19(15,16)17;/h3-5,11H,1-2H2,(H,12,13)(H,15,16,17);/q;+1/p-1 |
| InChIKey | AASJPTMJJMCSRE-UHFFFAOYSA-M |
| XLogP | -4.55 |
| TPSA | 141.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | -4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|