C12H14LiO9S — CID 57489105
CID 57489105 (PubChem CID 57489105) has the molecular formula C12H14LiO9S and a molecular weight of 341.24 g/mol.
| Compound Name | CID 57489105 |
|---|---|
| PubChem CID | 57489105 |
| Molecular Formula | C12H14LiO9S |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | — |
| SMILES | O=C(OCCO)c1cc(C(=O)OCCO)cc(S(=O)(=O)O)c1.[Li] |
| InChI | InChI=1S/C12H14O9S.Li/c13-1-3-20-11(15)8-5-9(12(16)21-4-2-14)7-10(6-8)22(17,18)19;/h5-7,13-14H,1-4H2,(H,17,18,19); |
| InChIKey | BCNFQODTYSMNMI-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|