C11H14O9S — CID 174990152
propane-1,3-diol;5-sulfobenzene-1,3-dicarboxylic acid (PubChem CID 174990152) has the molecular formula C11H14O9S and a molecular weight of 322.29 g/mol. Its IUPAC name is propane-1,3-diol;5-sulfobenzene-1,3-dicarboxylic acid.
| Compound Name | propane-1,3-diol;5-sulfobenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174990152 |
| Molecular Formula | C11H14O9S |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | propane-1,3-diol;5-sulfobenzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)cc(S(=O)(=O)O)c1.OCCCO |
| InChI | InChI=1S/C8H6O7S.C3H8O2/c9-7(10)4-1-5(8(11)12)3-6(2-4)16(13,14)15;4-2-1-3-5/h1-3H,(H,9,10)(H,11,12)(H,13,14,15);4-5H,1-3H2 |
| InChIKey | MTHMEWQMZIQHCO-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 169.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|