C22H38O7PS+ — CID 87434086
5-sulfobenzene-1,3-dicarboxylic acid;tributyl(ethyl)phosphanium (PubChem CID 87434086) has the molecular formula C22H38O7PS+ and a molecular weight of 477.58 g/mol. Its IUPAC name is 5-sulfobenzene-1,3-dicarboxylic acid;tributyl(ethyl)phosphanium.
| Compound Name | 5-sulfobenzene-1,3-dicarboxylic acid;tributyl(ethyl)phosphanium |
|---|---|
| PubChem CID | 87434086 |
| Molecular Formula | C22H38O7PS+ |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 5-sulfobenzene-1,3-dicarboxylic acid;tributyl(ethyl)phosphanium |
| SMILES | CCCC[P+](CC)(CCCC)CCCC.O=C(O)c1cc(C(=O)O)cc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C14H32P.C8H6O7S/c1-5-9-12-15(8-4,13-10-6-2)14-11-7-3;9-7(10)4-1-5(8(11)12)3-6(2-4)16(13,14)15/h5-14H2,1-4H3;1-3H,(H,9,10)(H,11,12)(H,13,14,15)/q+1; |
| InChIKey | FJLXSXDWZGPAON-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|